C20H31ClN2 — CID 68853104
1-[2-(3-chlorophenyl)-2-cyclohexylethyl]-N-methylpiperidin-2-amine (PubChem CID 68853104) has the molecular formula C20H31ClN2 and a molecular weight of 334.93 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)-2-cyclohexylethyl]-N-methylpiperidin-2-amine.
| Compound Name | 1-[2-(3-chlorophenyl)-2-cyclohexylethyl]-N-methylpiperidin-2-amine |
|---|---|
| PubChem CID | 68853104 |
| Molecular Formula | C20H31ClN2 |
| Molecular Weight | 334.93 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 1-[2-(3-chlorophenyl)-2-cyclohexylethyl]-N-methylpiperidin-2-amine |
| SMILES | CNC1CCCCN1CC(c1cccc(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C20H31ClN2/c1-22-20-12-5-6-13-23(20)15-19(16-8-3-2-4-9-16)17-10-7-11-18(21)14-17/h7,10-11,14,16,19-20,22H,2-6,8-9,12-13,15H2,1H3 |
| InChIKey | RSUKHSWUBFGHEI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.93 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |