C21H30Cl2N2 — CID 141046563
1-(3,3-diphenylpropyl)-N-methylpiperidin-2-amine;dihydrochloride (PubChem CID 141046563) has the molecular formula C21H30Cl2N2 and a molecular weight of 381.39 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-N-methylpiperidin-2-amine;dihydrochloride.
| Compound Name | 1-(3,3-diphenylpropyl)-N-methylpiperidin-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 141046563 |
| Molecular Formula | C21H30Cl2N2 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-N-methylpiperidin-2-amine;dihydrochloride |
| SMILES | CNC1CCCCN1CCC(c1ccccc1)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C21H28N2.2ClH/c1-22-21-14-8-9-16-23(21)17-15-20(18-10-4-2-5-11-18)19-12-6-3-7-13-19;;/h2-7,10-13,20-22H,8-9,14-17H2,1H3;2*1H |
| InChIKey | ZTAYPIIYIAWHPU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |