C7H8O — CID 68853780
6-oxabicyclo[3.2.1]octa-1,3-diene (PubChem CID 68853780) has the molecular formula C7H8O and a molecular weight of 108.14 g/mol. Its IUPAC name is 6-oxabicyclo[3.2.1]octa-1,3-diene.
| Compound Name | 6-oxabicyclo[3.2.1]octa-1,3-diene |
|---|---|
| PubChem CID | 68853780 |
| Molecular Formula | C7H8O |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.06 |
| IUPAC Name | 6-oxabicyclo[3.2.1]octa-1,3-diene |
| SMILES | C1=CC2CC(=C1)CO2 |
| InChI | InChI=1S/C7H8O/c1-2-6-4-7(3-1)8-5-6/h1-3,7H,4-5H2 |
| InChIKey | RJVUQFPOEORUFS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |