C22H26O6 — CID 68854069
(2S)-2-ethoxy-3-[4-(2-oxo-2-phenylmethoxyethoxy)phenyl]pentanoic acid (PubChem CID 68854069) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is (2S)-2-ethoxy-3-[4-(2-oxo-2-phenylmethoxyethoxy)phenyl]pentanoic acid.
| Compound Name | (2S)-2-ethoxy-3-[4-(2-oxo-2-phenylmethoxyethoxy)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 68854069 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (2S)-2-ethoxy-3-[4-(2-oxo-2-phenylmethoxyethoxy)phenyl]pentanoic acid |
| SMILES | CCO[C@H](C(=O)O)C(CC)c1ccc(OCC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H26O6/c1-3-19(21(22(24)25)26-4-2)17-10-12-18(13-11-17)27-15-20(23)28-14-16-8-6-5-7-9-16/h5-13,19,21H,3-4,14-15H2,1-2H3,(H,24,25)/t19?,21-/m0/s1 |
| InChIKey | JRSOOWZHPJDAOX-QWAKEFERSA-N |
| XLogP | 3.79 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |