C17H25NO4 — CID 68856997
2-[3-(cyclohexylmethoxy)phenoxy]propylcarbamic acid (PubChem CID 68856997) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-[3-(cyclohexylmethoxy)phenoxy]propylcarbamic acid.
| Compound Name | 2-[3-(cyclohexylmethoxy)phenoxy]propylcarbamic acid |
|---|---|
| PubChem CID | 68856997 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 2-[3-(cyclohexylmethoxy)phenoxy]propylcarbamic acid |
| SMILES | CC(CNC(=O)O)Oc1cccc(OCC2CCCCC2)c1 |
| InChI | InChI=1S/C17H25NO4/c1-13(11-18-17(19)20)22-16-9-5-8-15(10-16)21-12-14-6-3-2-4-7-14/h5,8-10,13-14,18H,2-4,6-7,11-12H2,1H3,(H,19,20) |
| InChIKey | GEHRTCOUPPXOBM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |