C16H23NO4 — CID 143785987
2-[3-(cyclopentylmethoxy)phenoxy]propyl carbamate (PubChem CID 143785987) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 2-[3-(cyclopentylmethoxy)phenoxy]propyl carbamate.
| Compound Name | 2-[3-(cyclopentylmethoxy)phenoxy]propyl carbamate |
|---|---|
| PubChem CID | 143785987 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-[3-(cyclopentylmethoxy)phenoxy]propyl carbamate |
| SMILES | CC(COC(N)=O)Oc1cccc(OCC2CCCC2)c1 |
| InChI | InChI=1S/C16H23NO4/c1-12(10-20-16(17)18)21-15-8-4-7-14(9-15)19-11-13-5-2-3-6-13/h4,7-9,12-13H,2-3,5-6,10-11H2,1H3,(H2,17,18) |
| InChIKey | GARCJBIBIWLGOA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |