C26H39N7O3 — CID 68859950
3-(3,5-dimethoxyphenyl)-1-ethyl-7-[5-(4-methylpiperazin-1-yl)pentylamino]-4H-pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 68859950) has the molecular formula C26H39N7O3 and a molecular weight of 497.64 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-1-ethyl-7-[5-(4-methylpiperazin-1-yl)pentylamino]-4H-pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 3-(3,5-dimethoxyphenyl)-1-ethyl-7-[5-(4-methylpiperazin-1-yl)pentylamino]-4H-pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 68859950 |
| Molecular Formula | C26H39N7O3 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.31 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-1-ethyl-7-[5-(4-methylpiperazin-1-yl)pentylamino]-4H-pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | CCN1C(=O)N(c2cc(OC)cc(OC)c2)Cc2cnc(NCCCCCN3CCN(C)CC3)nc21 |
| InChI | InChI=1S/C26H39N7O3/c1-5-32-24-20(19-33(26(32)34)21-15-22(35-3)17-23(16-21)36-4)18-28-25(29-24)27-9-7-6-8-10-31-13-11-30(2)12-14-31/h15-18H,5-14,19H2,1-4H3,(H,27,28,29) |
| InChIKey | ZUCAKYBJNRNMNB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|