C25H20N2O4 — CID 68864244
N'-(4-methoxybenzoyl)-3,4-diphenylfuran-2-carbohydrazide (PubChem CID 68864244) has the molecular formula C25H20N2O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is N'-(4-methoxybenzoyl)-3,4-diphenylfuran-2-carbohydrazide.
| Compound Name | N'-(4-methoxybenzoyl)-3,4-diphenylfuran-2-carbohydrazide |
|---|---|
| PubChem CID | 68864244 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N'-(4-methoxybenzoyl)-3,4-diphenylfuran-2-carbohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2occ(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20N2O4/c1-30-20-14-12-19(13-15-20)24(28)26-27-25(29)23-22(18-10-6-3-7-11-18)21(16-31-23)17-8-4-2-5-9-17/h2-16H,1H3,(H,26,28)(H,27,29) |
| InChIKey | JGIRHVNUTKPOFI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|