C17H25N3O4 — CID 68868014
(3R)-1-tert-butyl-3-[(2-nitroanilino)methyl]piperidin-1-ium-1-carboxylate (PubChem CID 68868014) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is (3R)-1-tert-butyl-3-[(2-nitroanilino)methyl]piperidin-1-ium-1-carboxylate.
| Compound Name | (3R)-1-tert-butyl-3-[(2-nitroanilino)methyl]piperidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 68868014 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | (3R)-1-tert-butyl-3-[(2-nitroanilino)methyl]piperidin-1-ium-1-carboxylate |
| SMILES | CC(C)(C)[N+]1(C(=O)[O-])CCC[C@H](CNc2ccccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C17H25N3O4/c1-17(2,3)20(16(21)22)10-6-7-13(12-20)11-18-14-8-4-5-9-15(14)19(23)24/h4-5,8-9,13,18H,6-7,10-12H2,1-3H3/t13-,20?/m1/s1 |
| InChIKey | DZAFSOLMLYXJLY-CRIUFTBBSA-N |
| XLogP | 2.38 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|