C34H49N7O4 — CID 68868567
tert-butyl-[N-tert-butyl-N'-carboxy-N-[2,2-dimethyl-3-[2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]benzimidazol-1-yl]propyl]carbamimidoyl]carbamic acid (PubChem CID 68868567) has the molecular formula C34H49N7O4 and a molecular weight of 619.81 g/mol. Its IUPAC name is tert-butyl-[N-tert-butyl-N'-carboxy-N-[2,2-dimethyl-3-[2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]benzimidazol-1-yl]propyl]carbamimidoyl]carbamic acid.
| Compound Name | tert-butyl-[N-tert-butyl-N'-carboxy-N-[2,2-dimethyl-3-[2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]benzimidazol-1-yl]propyl]carbamimidoyl]carbamic acid |
|---|---|
| PubChem CID | 68868567 |
| Molecular Formula | C34H49N7O4 |
| Molecular Weight | 619.81 g/mol |
| Exact Mass | 619.38 |
| IUPAC Name | tert-butyl-[N-tert-butyl-N'-carboxy-N-[2,2-dimethyl-3-[2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]benzimidazol-1-yl]propyl]carbamimidoyl]carbamic acid |
| SMILES | CN(Cc1nc2ccccc2n1CC(C)(C)CN(C(=NC(=O)O)N(C(=O)O)C(C)(C)C)C(C)(C)C)C1CCCc2cccnc21 |
| InChI | InChI=1S/C34H49N7O4/c1-32(2,3)40(29(37-30(42)43)41(31(44)45)33(4,5)6)22-34(7,8)21-39-25-17-11-10-16-24(25)36-27(39)20-38(9)26-18-12-14-23-15-13-19-35-28(23)26/h10-11,13,15-17,19,26H,12,14,18,20-22H2,1-9H3,(H,42,43)(H,44,45) |
| InChIKey | WOIQGSXTZGYXHR-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.81 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|