C35H51N7O4 — CID 69248597
tert-butyl-[1-(carboxyamino)-2,2-dimethyl-1-[(3R)-3-[[2-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]benzimidazol-1-yl]methyl]piperidin-1-yl]propyl]carbamic acid (PubChem CID 69248597) has the molecular formula C35H51N7O4 and a molecular weight of 633.84 g/mol. Its IUPAC name is tert-butyl-[1-(carboxyamino)-2,2-dimethyl-1-[(3R)-3-[[2-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]benzimidazol-1-yl]methyl]piperidin-1-yl]propyl]carbamic acid.
| Compound Name | tert-butyl-[1-(carboxyamino)-2,2-dimethyl-1-[(3R)-3-[[2-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]benzimidazol-1-yl]methyl]piperidin-1-yl]propyl]carbamic acid |
|---|---|
| PubChem CID | 69248597 |
| Molecular Formula | C35H51N7O4 |
| Molecular Weight | 633.84 g/mol |
| Exact Mass | 633.40 |
| IUPAC Name | tert-butyl-[1-(carboxyamino)-2,2-dimethyl-1-[(3R)-3-[[2-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]benzimidazol-1-yl]methyl]piperidin-1-yl]propyl]carbamic acid |
| SMILES | CN(Cc1nc2ccccc2n1C[C@@H]1CCCN(C(NC(=O)O)(N(C(=O)O)C(C)(C)C)C(C)(C)C)C1)[C@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C35H51N7O4/c1-33(2,3)35(38-31(43)44,42(32(45)46)34(4,5)6)40-20-12-13-24(21-40)22-41-27-17-9-8-16-26(27)37-29(41)23-39(7)28-18-10-14-25-15-11-19-36-30(25)28/h8-9,11,15-17,19,24,28,38H,10,12-14,18,20-23H2,1-7H3,(H,43,44)(H,45,46)/t24-,28+,35?/m1/s1 |
| InChIKey | WSWRKHIEIFYHTD-SPDMXRQYSA-N |
| XLogP | 6.40 |
| TPSA | 127.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.84 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|