C14H8FIN2O2S — CID 68870359
3-(2-fluoro-4-iodoanilino)thieno[2,3-c]pyridine-2-carboxylic acid (PubChem CID 68870359) has the molecular formula C14H8FIN2O2S and a molecular weight of 414.20 g/mol. Its IUPAC name is 3-(2-fluoro-4-iodoanilino)thieno[2,3-c]pyridine-2-carboxylic acid.
| Compound Name | 3-(2-fluoro-4-iodoanilino)thieno[2,3-c]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 68870359 |
| Molecular Formula | C14H8FIN2O2S |
| Molecular Weight | 414.20 g/mol |
| Exact Mass | 413.93 |
| IUPAC Name | 3-(2-fluoro-4-iodoanilino)thieno[2,3-c]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1sc2cnccc2c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C14H8FIN2O2S/c15-9-5-7(16)1-2-10(9)18-12-8-3-4-17-6-11(8)21-13(12)14(19)20/h1-6,18H,(H,19,20) |
| InChIKey | OQJZTOZMWHULOZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.20 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|