1,2,2-trifluoroethyl isoquinoline-3-carboxylate

C12H8F3NO2 — CID 68871944

IUPAC1,2,2-trifluoroethyl isoquinoline-3-carboxylate
SMILESO=C(OC(F)C(F)F)c1cc2ccccc2cn1
InChIInChI=1S/C12H8F3NO2/c13-10(14)11(15)18-12(17)9-5-7-3-1-2-4-8(7)6-16-9/h1-6,10-11H
InChIKeyVNRULAVXFWGJSB-UHFFFAOYSA-N
MW255.20 g/mol
LogP2.95
Rot. Bonds3

About 1,2,2-trifluoroethyl isoquinoline-3-carboxylate

1,2,2-trifluoroethyl isoquinoline-3-carboxylate (PubChem CID 68871944) has the molecular formula C12H8F3NO2 and a molecular weight of 255.20 g/mol. Its IUPAC name is 1,2,2-trifluoroethyl isoquinoline-3-carboxylate.

Molecular Properties

Compound Name1,2,2-trifluoroethyl isoquinoline-3-carboxylate
PubChem CID68871944
Molecular FormulaC12H8F3NO2
Molecular Weight255.20 g/mol
Exact Mass255.05
IUPAC Name1,2,2-trifluoroethyl isoquinoline-3-carboxylate
SMILESO=C(OC(F)C(F)F)c1cc2ccccc2cn1
InChIInChI=1S/C12H8F3NO2/c13-10(14)11(15)18-12(17)9-5-7-3-1-2-4-8(7)6-16-9/h1-6,10-11H
InChIKeyVNRULAVXFWGJSB-UHFFFAOYSA-N
XLogP2.95
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.20
LogP ≤ 52.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 1,2,2-trifluoroethyl isoquinoline-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2,2-trifluoroethyl isoquinoline-3-carboxylate?
The IUPAC name of 1,2,2-trifluoroethyl isoquinoline-3-carboxylate (CID 68871944) is 1,2,2-trifluoroethyl isoquinoline-3-carboxylate.
What is the SMILES notation for 1,2,2-trifluoroethyl isoquinoline-3-carboxylate?
The canonical SMILES for 1,2,2-trifluoroethyl isoquinoline-3-carboxylate is O=C(OC(F)C(F)F)c1cc2ccccc2cn1.
What is the InChIKey of 1,2,2-trifluoroethyl isoquinoline-3-carboxylate?
The InChIKey is VNRULAVXFWGJSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F3NO2/c13-10(14)11(15)18-12(17)9-5-7-3-1-2-4-8(7)6-16-9/h1-6,10-11H.
What are the key properties of 1,2,2-trifluoroethyl isoquinoline-3-carboxylate?
1,2,2-trifluoroethyl isoquinoline-3-carboxylate has a molecular weight of 255.20 g/mol, XLogP of 2.95, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2-trifluoroethyl isoquinoline-3-carboxylate is sourced from PubChem (CID 68871944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).