C22H23N5O — CID 68872034
[4-[[4-(3-amino-2-methylphenyl)pyrimidin-2-yl]amino]phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 68872034) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is [4-[[4-(3-amino-2-methylphenyl)pyrimidin-2-yl]amino]phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-[[4-(3-amino-2-methylphenyl)pyrimidin-2-yl]amino]phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 68872034 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | [4-[[4-(3-amino-2-methylphenyl)pyrimidin-2-yl]amino]phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | Cc1c(N)cccc1-c1ccnc(Nc2ccc(C(=O)N3CCCC3)cc2)n1 |
| InChI | InChI=1S/C22H23N5O/c1-15-18(5-4-6-19(15)23)20-11-12-24-22(26-20)25-17-9-7-16(8-10-17)21(28)27-13-2-3-14-27/h4-12H,2-3,13-14,23H2,1H3,(H,24,25,26) |
| InChIKey | SVWJRQCHILBZBV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|