About 4-[[4-(3-amino-2-methylphenyl)pyrimidin-2-yl]amino]-N,N-dibenzylbenzamide
4-[[4-(3-amino-2-methylphenyl)pyrimidin-2-yl]amino]-N,N-dibenzylbenzamide (PubChem CID 69269219) has the molecular formula C32H29N5O
and a molecular weight of 499.62 g/mol. Its IUPAC name is 4-[[4-(3-amino-2-methylphenyl)pyrimidin-2-yl]amino]-N,N-dibenzylbenzamide.
Molecular Properties
| Compound Name | 4-[[4-(3-amino-2-methylphenyl)pyrimidin-2-yl]amino]-N,N-dibenzylbenzamide |
| PubChem CID | 69269219 |
| Molecular Formula | C32H29N5O |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | 4-[[4-(3-amino-2-methylphenyl)pyrimidin-2-yl]amino]-N,N-dibenzylbenzamide |
| SMILES | Cc1c(N)cccc1-c1ccnc(Nc2ccc(C(=O)N(Cc3ccccc3)Cc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C32H29N5O/c1-23-28(13-8-14-29(23)33)30-19-20-34-32(36-30)35-27-17-15-26(16-18-27)31(38)37(21-24-9-4-2-5-10-24)22-25-11-6-3-7-12-25/h2-20H,21-22,33H2,1H3,(H,34,35,36) |
| InChIKey | ZDQSCMGSIMULKQ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4-(3-amino-2-methylphenyl)pyrimidin-2-yl]amino]-N,N-dibenzylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(3-amino-2-methylphenyl)pyrimidin-2-yl]amino]-N,N-dibenzylbenzamide?
The IUPAC name of 4-[[4-(3-amino-2-methylphenyl)pyrimidin-2-yl]amino]-N,N-dibenzylbenzamide (CID 69269219) is 4-[[4-(3-amino-2-methylphenyl)pyrimidin-2-yl]amino]-N,N-dibenzylbenzamide.
What is the SMILES notation for 4-[[4-(3-amino-2-methylphenyl)pyrimidin-2-yl]amino]-N,N-dibenzylbenzamide?
The canonical SMILES for 4-[[4-(3-amino-2-methylphenyl)pyrimidin-2-yl]amino]-N,N-dibenzylbenzamide is Cc1c(N)cccc1-c1ccnc(Nc2ccc(C(=O)N(Cc3ccccc3)Cc3ccccc3)cc2)n1.
What is the InChIKey of 4-[[4-(3-amino-2-methylphenyl)pyrimidin-2-yl]amino]-N,N-dibenzylbenzamide?
The InChIKey is ZDQSCMGSIMULKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H29N5O/c1-23-28(13-8-14-29(23)33)30-19-20-34-32(36-30)35-27-17-15-26(16-18-27)31(38)37(21-24-9-4-2-5-10-24)22-25-11-6-3-7-12-25/h2-20H,21-22,33H2,1H3,(H,34,35,36).
What are the key properties of 4-[[4-(3-amino-2-methylphenyl)pyrimidin-2-yl]amino]-N,N-dibenzylbenzamide?
4-[[4-(3-amino-2-methylphenyl)pyrimidin-2-yl]amino]-N,N-dibenzylbenzamide has a molecular weight of 499.62 g/mol, XLogP of 6.62, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(3-amino-2-methylphenyl)pyrimidin-2-yl]amino]-N,N-dibenzylbenzamide is sourced from PubChem (CID 69269219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).