C20H24ClF3N2O3 — CID 68872755
[4-[1-(dimethylamino)-3-(2,3,4-trifluorophenoxy)propyl]phenyl] N,N-dimethylcarbamate;hydrochloride (PubChem CID 68872755) has the molecular formula C20H24ClF3N2O3 and a molecular weight of 432.87 g/mol. Its IUPAC name is [4-[1-(dimethylamino)-3-(2,3,4-trifluorophenoxy)propyl]phenyl] N,N-dimethylcarbamate;hydrochloride.
| Compound Name | [4-[1-(dimethylamino)-3-(2,3,4-trifluorophenoxy)propyl]phenyl] N,N-dimethylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 68872755 |
| Molecular Formula | C20H24ClF3N2O3 |
| Molecular Weight | 432.87 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | [4-[1-(dimethylamino)-3-(2,3,4-trifluorophenoxy)propyl]phenyl] N,N-dimethylcarbamate;hydrochloride |
| SMILES | CN(C)C(=O)Oc1ccc(C(CCOc2ccc(F)c(F)c2F)N(C)C)cc1.Cl |
| InChI | InChI=1S/C20H23F3N2O3.ClH/c1-24(2)16(11-12-27-17-10-9-15(21)18(22)19(17)23)13-5-7-14(8-6-13)28-20(26)25(3)4;/h5-10,16H,11-12H2,1-4H3;1H |
| InChIKey | CGPCIPAAZMDKDE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.87 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|