C19H27N3O2S — CID 68873861
8-[4-(1,1-dihydroxythian-4-yl)piperazin-1-yl]-2-methylquinoline (PubChem CID 68873861) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is 8-[4-(1,1-dihydroxythian-4-yl)piperazin-1-yl]-2-methylquinoline.
| Compound Name | 8-[4-(1,1-dihydroxythian-4-yl)piperazin-1-yl]-2-methylquinoline |
|---|---|
| PubChem CID | 68873861 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 8-[4-(1,1-dihydroxythian-4-yl)piperazin-1-yl]-2-methylquinoline |
| SMILES | Cc1ccc2cccc(N3CCN(C4CCS(O)(O)CC4)CC3)c2n1 |
| InChI | InChI=1S/C19H27N3O2S/c1-15-5-6-16-3-2-4-18(19(16)20-15)22-11-9-21(10-12-22)17-7-13-25(23,24)14-8-17/h2-6,17,23-24H,7-14H2,1H3 |
| InChIKey | ZWCKULAMOJUEFL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |