C21H24ClN3O5 — CID 68874403
[(1R)-1-[2-(4-nitrophenoxy)ethyl]-2,3-dihydro-1H-2-benzazepin-7-yl] N,N-dimethylcarbamate;hydrochloride (PubChem CID 68874403) has the molecular formula C21H24ClN3O5 and a molecular weight of 433.89 g/mol. Its IUPAC name is [(1R)-1-[2-(4-nitrophenoxy)ethyl]-2,3-dihydro-1H-2-benzazepin-7-yl] N,N-dimethylcarbamate;hydrochloride.
| Compound Name | [(1R)-1-[2-(4-nitrophenoxy)ethyl]-2,3-dihydro-1H-2-benzazepin-7-yl] N,N-dimethylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 68874403 |
| Molecular Formula | C21H24ClN3O5 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | [(1R)-1-[2-(4-nitrophenoxy)ethyl]-2,3-dihydro-1H-2-benzazepin-7-yl] N,N-dimethylcarbamate;hydrochloride |
| SMILES | CN(C)C(=O)Oc1ccc2c(c1)C=CCN[C@@H]2CCOc1ccc([N+](=O)[O-])cc1.Cl |
| InChI | InChI=1S/C21H23N3O5.ClH/c1-23(2)21(25)29-18-9-10-19-15(14-18)4-3-12-22-20(19)11-13-28-17-7-5-16(6-8-17)24(26)27;/h3-10,14,20,22H,11-13H2,1-2H3;1H/t20-;/m1./s1 |
| InChIKey | ZKOMOXACMGAGOX-VEIFNGETSA-N |
| XLogP | 4.20 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|