C26H29ClN4O2 — CID 68875766
2-[3-chloro-1-[4-(1-methylpiperidin-4-yl)butyl]indol-4-yl]-3H-benzimidazole-5-carboxylic acid (PubChem CID 68875766) has the molecular formula C26H29ClN4O2 and a molecular weight of 465.00 g/mol. Its IUPAC name is 2-[3-chloro-1-[4-(1-methylpiperidin-4-yl)butyl]indol-4-yl]-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-[3-chloro-1-[4-(1-methylpiperidin-4-yl)butyl]indol-4-yl]-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 68875766 |
| Molecular Formula | C26H29ClN4O2 |
| Molecular Weight | 465.00 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 2-[3-chloro-1-[4-(1-methylpiperidin-4-yl)butyl]indol-4-yl]-3H-benzimidazole-5-carboxylic acid |
| SMILES | CN1CCC(CCCCn2cc(Cl)c3c(-c4nc5ccc(C(=O)O)cc5[nH]4)cccc32)CC1 |
| InChI | InChI=1S/C26H29ClN4O2/c1-30-13-10-17(11-14-30)5-2-3-12-31-16-20(27)24-19(6-4-7-23(24)31)25-28-21-9-8-18(26(32)33)15-22(21)29-25/h4,6-9,15-17H,2-3,5,10-14H2,1H3,(H,28,29)(H,32,33) |
| InChIKey | RCGHRRMYFSFJAU-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.00 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|