C31H34N4 — CID 141392150
2-[1-[4-(1-methylpiperidin-4-yl)butyl]indol-4-yl]-6-phenyl-1H-benzimidazole (PubChem CID 141392150) has the molecular formula C31H34N4 and a molecular weight of 462.64 g/mol. Its IUPAC name is 2-[1-[4-(1-methylpiperidin-4-yl)butyl]indol-4-yl]-6-phenyl-1H-benzimidazole.
| Compound Name | 2-[1-[4-(1-methylpiperidin-4-yl)butyl]indol-4-yl]-6-phenyl-1H-benzimidazole |
|---|---|
| PubChem CID | 141392150 |
| Molecular Formula | C31H34N4 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 2-[1-[4-(1-methylpiperidin-4-yl)butyl]indol-4-yl]-6-phenyl-1H-benzimidazole |
| SMILES | CN1CCC(CCCCn2ccc3c(-c4nc5ccc(-c6ccccc6)cc5[nH]4)cccc32)CC1 |
| InChI | InChI=1S/C31H34N4/c1-34-19-15-23(16-20-34)8-5-6-18-35-21-17-26-27(11-7-12-30(26)35)31-32-28-14-13-25(22-29(28)33-31)24-9-3-2-4-10-24/h2-4,7,9-14,17,21-23H,5-6,8,15-16,18-20H2,1H3,(H,32,33) |
| InChIKey | VXCYIATZPSOTAL-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|