C23H29N5O3 — CID 68657468
methyl [2-[6-[3-(1-methylpiperidin-4-yl)propylamino]-3-pyridinyl]-3H-benzimidazol-5-yl] carbonate (PubChem CID 68657468) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is methyl [2-[6-[3-(1-methylpiperidin-4-yl)propylamino]-3-pyridinyl]-3H-benzimidazol-5-yl] carbonate.
| Compound Name | methyl [2-[6-[3-(1-methylpiperidin-4-yl)propylamino]-3-pyridinyl]-3H-benzimidazol-5-yl] carbonate |
|---|---|
| PubChem CID | 68657468 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | methyl [2-[6-[3-(1-methylpiperidin-4-yl)propylamino]-3-pyridinyl]-3H-benzimidazol-5-yl] carbonate |
| SMILES | COC(=O)Oc1ccc2nc(-c3ccc(NCCCC4CCN(C)CC4)nc3)[nH]c2c1 |
| InChI | InChI=1S/C23H29N5O3/c1-28-12-9-16(10-13-28)4-3-11-24-21-8-5-17(15-25-21)22-26-19-7-6-18(14-20(19)27-22)31-23(29)30-2/h5-8,14-16H,3-4,9-13H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | UJCZKGXFOUBFCA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|