C25H37N5 — CID 143556403
5-(6-tert-butyl-1H-benzimidazol-2-yl)-N-[3-(1-methylpiperidin-4-yl)propyl]-1,2-dihydropyridin-2-amine (PubChem CID 143556403) has the molecular formula C25H37N5 and a molecular weight of 407.61 g/mol. Its IUPAC name is 5-(6-tert-butyl-1H-benzimidazol-2-yl)-N-[3-(1-methylpiperidin-4-yl)propyl]-1,2-dihydropyridin-2-amine.
| Compound Name | 5-(6-tert-butyl-1H-benzimidazol-2-yl)-N-[3-(1-methylpiperidin-4-yl)propyl]-1,2-dihydropyridin-2-amine |
|---|---|
| PubChem CID | 143556403 |
| Molecular Formula | C25H37N5 |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | 5-(6-tert-butyl-1H-benzimidazol-2-yl)-N-[3-(1-methylpiperidin-4-yl)propyl]-1,2-dihydropyridin-2-amine |
| SMILES | CN1CCC(CCCNC2C=CC(c3nc4ccc(C(C)(C)C)cc4[nH]3)=CN2)CC1 |
| InChI | InChI=1S/C25H37N5/c1-25(2,3)20-8-9-21-22(16-20)29-24(28-21)19-7-10-23(27-17-19)26-13-5-6-18-11-14-30(4)15-12-18/h7-10,16-18,23,26-27H,5-6,11-15H2,1-4H3,(H,28,29) |
| InChIKey | WPACDKRQALHVKS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|