C22H30N6O — CID 24804548
5-(6-methoxy-1H-benzimidazol-2-yl)-4-methyl-N-[3-(1-methylpiperidin-4-yl)propyl]pyrimidin-2-amine (PubChem CID 24804548) has the molecular formula C22H30N6O and a molecular weight of 394.52 g/mol. Its IUPAC name is 5-(6-methoxy-1H-benzimidazol-2-yl)-4-methyl-N-[3-(1-methylpiperidin-4-yl)propyl]pyrimidin-2-amine.
| Compound Name | 5-(6-methoxy-1H-benzimidazol-2-yl)-4-methyl-N-[3-(1-methylpiperidin-4-yl)propyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 24804548 |
| Molecular Formula | C22H30N6O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 5-(6-methoxy-1H-benzimidazol-2-yl)-4-methyl-N-[3-(1-methylpiperidin-4-yl)propyl]pyrimidin-2-amine |
| SMILES | COc1ccc2nc(-c3cnc(NCCCC4CCN(C)CC4)nc3C)[nH]c2c1 |
| InChI | InChI=1S/C22H30N6O/c1-15-18(21-26-19-7-6-17(29-3)13-20(19)27-21)14-24-22(25-15)23-10-4-5-16-8-11-28(2)12-9-16/h6-7,13-14,16H,4-5,8-12H2,1-3H3,(H,26,27)(H,23,24,25) |
| InChIKey | RDJBCNLPTKFHQB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|