C28H40N4O — CID 59812220
5-tert-butyl-4-methyl-2-[5-methyl-2-[4-(1-methylpiperidin-4-yl)butoxy]-4-pyridinyl]-1H-benzimidazole (PubChem CID 59812220) has the molecular formula C28H40N4O and a molecular weight of 448.66 g/mol. Its IUPAC name is 5-tert-butyl-4-methyl-2-[5-methyl-2-[4-(1-methylpiperidin-4-yl)butoxy]-4-pyridinyl]-1H-benzimidazole.
| Compound Name | 5-tert-butyl-4-methyl-2-[5-methyl-2-[4-(1-methylpiperidin-4-yl)butoxy]-4-pyridinyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 59812220 |
| Molecular Formula | C28H40N4O |
| Molecular Weight | 448.66 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | 5-tert-butyl-4-methyl-2-[5-methyl-2-[4-(1-methylpiperidin-4-yl)butoxy]-4-pyridinyl]-1H-benzimidazole |
| SMILES | Cc1cnc(OCCCCC2CCN(C)CC2)cc1-c1nc2c(C)c(C(C)(C)C)ccc2[nH]1 |
| InChI | InChI=1S/C28H40N4O/c1-19-18-29-25(33-16-8-7-9-21-12-14-32(6)15-13-21)17-22(19)27-30-24-11-10-23(28(3,4)5)20(2)26(24)31-27/h10-11,17-18,21H,7-9,12-16H2,1-6H3,(H,30,31) |
| InChIKey | FIGQIUGBXYXWDF-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.66 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|