C22H26ClFN4O — CID 11395949
2-[2-chloro-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-5-fluoro-4-methyl-1H-benzimidazole (PubChem CID 11395949) has the molecular formula C22H26ClFN4O and a molecular weight of 416.93 g/mol. Its IUPAC name is 2-[2-chloro-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-5-fluoro-4-methyl-1H-benzimidazole.
| Compound Name | 2-[2-chloro-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-5-fluoro-4-methyl-1H-benzimidazole |
|---|---|
| PubChem CID | 11395949 |
| Molecular Formula | C22H26ClFN4O |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 2-[2-chloro-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-5-fluoro-4-methyl-1H-benzimidazole |
| SMILES | Cc1c(F)ccc2[nH]c(-c3ccc(OCCCN4CCN(C)CC4)cc3Cl)nc12 |
| InChI | InChI=1S/C22H26ClFN4O/c1-15-19(24)6-7-20-21(15)26-22(25-20)17-5-4-16(14-18(17)23)29-13-3-8-28-11-9-27(2)10-12-28/h4-7,14H,3,8-13H2,1-2H3,(H,25,26) |
| InChIKey | NPYCKTMZMUAVJW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|