C23H29ClN4O — CID 86761058
1-[2-chloro-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-4,5-dimethylbenzimidazole (PubChem CID 86761058) has the molecular formula C23H29ClN4O and a molecular weight of 412.97 g/mol. Its IUPAC name is 1-[2-chloro-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-4,5-dimethylbenzimidazole.
| Compound Name | 1-[2-chloro-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-4,5-dimethylbenzimidazole |
|---|---|
| PubChem CID | 86761058 |
| Molecular Formula | C23H29ClN4O |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1-[2-chloro-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-4,5-dimethylbenzimidazole |
| SMILES | Cc1ccc2c(ncn2-c2ccc(OCCCN3CCN(C)CC3)cc2Cl)c1C |
| InChI | InChI=1S/C23H29ClN4O/c1-17-5-7-22-23(18(17)2)25-16-28(22)21-8-6-19(15-20(21)24)29-14-4-9-27-12-10-26(3)11-13-27/h5-8,15-16H,4,9-14H2,1-3H3 |
| InChIKey | KDVUUKCVTIFUID-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|