C19H26ClN5O2 — CID 141139746
5-chloro-N-[2-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]pyrimidin-2-amine (PubChem CID 141139746) has the molecular formula C19H26ClN5O2 and a molecular weight of 391.90 g/mol. Its IUPAC name is 5-chloro-N-[2-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]pyrimidin-2-amine.
| Compound Name | 5-chloro-N-[2-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 141139746 |
| Molecular Formula | C19H26ClN5O2 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 5-chloro-N-[2-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]pyrimidin-2-amine |
| SMILES | COc1cc(OCCCN2CCN(C)CC2)ccc1Nc1ncc(Cl)cn1 |
| InChI | InChI=1S/C19H26ClN5O2/c1-24-7-9-25(10-8-24)6-3-11-27-16-4-5-17(18(12-16)26-2)23-19-21-13-15(20)14-22-19/h4-5,12-14H,3,6-11H2,1-2H3,(H,21,22,23) |
| InChIKey | OQZPTVMLJVWFEH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|