C25H31FN4O — CID 46890675
5-fluoro-4-methyl-2-[2-methyl-4-[3-(1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)propoxy]phenyl]-1H-benzimidazole (PubChem CID 46890675) has the molecular formula C25H31FN4O and a molecular weight of 422.55 g/mol. Its IUPAC name is 5-fluoro-4-methyl-2-[2-methyl-4-[3-(1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)propoxy]phenyl]-1H-benzimidazole.
| Compound Name | 5-fluoro-4-methyl-2-[2-methyl-4-[3-(1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)propoxy]phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 46890675 |
| Molecular Formula | C25H31FN4O |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 5-fluoro-4-methyl-2-[2-methyl-4-[3-(1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)propoxy]phenyl]-1H-benzimidazole |
| SMILES | Cc1cc(OCCCN2CC3CCN(C)C3C2)ccc1-c1nc2c(C)c(F)ccc2[nH]1 |
| InChI | InChI=1S/C25H31FN4O/c1-16-13-19(31-12-4-10-30-14-18-9-11-29(3)23(18)15-30)5-6-20(16)25-27-22-8-7-21(26)17(2)24(22)28-25/h5-8,13,18,23H,4,9-12,14-15H2,1-3H3,(H,27,28) |
| InChIKey | FGSBLNXBYOAEOJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|