C22H30N2O — CID 141127125
3-methyl-2-[2-methyl-4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]pyridine (PubChem CID 141127125) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 3-methyl-2-[2-methyl-4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]pyridine.
| Compound Name | 3-methyl-2-[2-methyl-4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]pyridine |
|---|---|
| PubChem CID | 141127125 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 3-methyl-2-[2-methyl-4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]pyridine |
| SMILES | Cc1cc(OCCCN2CCC[C@H](C)C2)ccc1-c1ncccc1C |
| InChI | InChI=1S/C22H30N2O/c1-17-7-5-12-24(16-17)13-6-14-25-20-9-10-21(19(3)15-20)22-18(2)8-4-11-23-22/h4,8-11,15,17H,5-7,12-14,16H2,1-3H3/t17-/m0/s1 |
| InChIKey | UADTVFLFCCDOTR-KRWDZBQOSA-N |
| XLogP | 4.87 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|