C23H29ClN4O — CID 59812222
2-[3-chloro-4-[3-(4-methyl-1,4-diazepan-1-yl)propoxy]phenyl]-4-methyl-1H-benzimidazole (PubChem CID 59812222) has the molecular formula C23H29ClN4O and a molecular weight of 412.97 g/mol. Its IUPAC name is 2-[3-chloro-4-[3-(4-methyl-1,4-diazepan-1-yl)propoxy]phenyl]-4-methyl-1H-benzimidazole.
| Compound Name | 2-[3-chloro-4-[3-(4-methyl-1,4-diazepan-1-yl)propoxy]phenyl]-4-methyl-1H-benzimidazole |
|---|---|
| PubChem CID | 59812222 |
| Molecular Formula | C23H29ClN4O |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2-[3-chloro-4-[3-(4-methyl-1,4-diazepan-1-yl)propoxy]phenyl]-4-methyl-1H-benzimidazole |
| SMILES | Cc1cccc2[nH]c(-c3ccc(OCCCN4CCCN(C)CC4)c(Cl)c3)nc12 |
| InChI | InChI=1S/C23H29ClN4O/c1-17-6-3-7-20-22(17)26-23(25-20)18-8-9-21(19(24)16-18)29-15-5-12-28-11-4-10-27(2)13-14-28/h3,6-9,16H,4-5,10-15H2,1-2H3,(H,25,26) |
| InChIKey | BHXFOAZKCRAEEO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|