C27H38N4O — CID 59812223
6-tert-butyl-2-[3-[4-(4-methyl-1,4-diazepan-1-yl)butoxy]phenyl]-1H-benzimidazole (PubChem CID 59812223) has the molecular formula C27H38N4O and a molecular weight of 434.63 g/mol. Its IUPAC name is 6-tert-butyl-2-[3-[4-(4-methyl-1,4-diazepan-1-yl)butoxy]phenyl]-1H-benzimidazole.
| Compound Name | 6-tert-butyl-2-[3-[4-(4-methyl-1,4-diazepan-1-yl)butoxy]phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 59812223 |
| Molecular Formula | C27H38N4O |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | 6-tert-butyl-2-[3-[4-(4-methyl-1,4-diazepan-1-yl)butoxy]phenyl]-1H-benzimidazole |
| SMILES | CN1CCCN(CCCCOc2cccc(-c3nc4ccc(C(C)(C)C)cc4[nH]3)c2)CC1 |
| InChI | InChI=1S/C27H38N4O/c1-27(2,3)22-11-12-24-25(20-22)29-26(28-24)21-9-7-10-23(19-21)32-18-6-5-14-31-15-8-13-30(4)16-17-31/h7,9-12,19-20H,5-6,8,13-18H2,1-4H3,(H,28,29) |
| InChIKey | HZBLUKOLSHDOPE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|