C26H36N4O — CID 11304713
6-tert-butyl-2-[4-[3-(4-methylpiperazin-1-yl)butoxy]phenyl]-1H-benzimidazole (PubChem CID 11304713) has the molecular formula C26H36N4O and a molecular weight of 420.60 g/mol. Its IUPAC name is 6-tert-butyl-2-[4-[3-(4-methylpiperazin-1-yl)butoxy]phenyl]-1H-benzimidazole.
| Compound Name | 6-tert-butyl-2-[4-[3-(4-methylpiperazin-1-yl)butoxy]phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 11304713 |
| Molecular Formula | C26H36N4O |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | 6-tert-butyl-2-[4-[3-(4-methylpiperazin-1-yl)butoxy]phenyl]-1H-benzimidazole |
| SMILES | CC(CCOc1ccc(-c2nc3ccc(C(C)(C)C)cc3[nH]2)cc1)N1CCN(C)CC1 |
| InChI | InChI=1S/C26H36N4O/c1-19(30-15-13-29(5)14-16-30)12-17-31-22-9-6-20(7-10-22)25-27-23-11-8-21(26(2,3)4)18-24(23)28-25/h6-11,18-19H,12-17H2,1-5H3,(H,27,28) |
| InChIKey | SYEXZEOVEMQXJE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |