About 5-bromo-4-(dimethoxymethyl)-2-[4-(1-methylpiperidin-4-yl)butoxy]pyridine;pyridine
5-bromo-4-(dimethoxymethyl)-2-[4-(1-methylpiperidin-4-yl)butoxy]pyridine;pyridine (PubChem CID 141240109) has the molecular formula C23H34BrN3O3
and a molecular weight of 480.45 g/mol. Its IUPAC name is 5-bromo-4-(dimethoxymethyl)-2-[4-(1-methylpiperidin-4-yl)butoxy]pyridine;pyridine.
Molecular Properties
| Compound Name | 5-bromo-4-(dimethoxymethyl)-2-[4-(1-methylpiperidin-4-yl)butoxy]pyridine;pyridine |
| PubChem CID | 141240109 |
| Molecular Formula | C23H34BrN3O3 |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 5-bromo-4-(dimethoxymethyl)-2-[4-(1-methylpiperidin-4-yl)butoxy]pyridine;pyridine |
| SMILES | COC(OC)c1cc(OCCCCC2CCN(C)CC2)ncc1Br.c1ccncc1 |
| InChI | InChI=1S/C18H29BrN2O3.C5H5N/c1-21-9-7-14(8-10-21)6-4-5-11-24-17-12-15(16(19)13-20-17)18(22-2)23-3;1-2-4-6-5-3-1/h12-14,18H,4-11H2,1-3H3;1-5H |
| InChIKey | KQWZQNNANCMDOI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-4-(dimethoxymethyl)-2-[4-(1-methylpiperidin-4-yl)butoxy]pyridine;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-(dimethoxymethyl)-2-[4-(1-methylpiperidin-4-yl)butoxy]pyridine;pyridine?
The IUPAC name of 5-bromo-4-(dimethoxymethyl)-2-[4-(1-methylpiperidin-4-yl)butoxy]pyridine;pyridine (CID 141240109) is 5-bromo-4-(dimethoxymethyl)-2-[4-(1-methylpiperidin-4-yl)butoxy]pyridine;pyridine.
What is the SMILES notation for 5-bromo-4-(dimethoxymethyl)-2-[4-(1-methylpiperidin-4-yl)butoxy]pyridine;pyridine?
The canonical SMILES for 5-bromo-4-(dimethoxymethyl)-2-[4-(1-methylpiperidin-4-yl)butoxy]pyridine;pyridine is COC(OC)c1cc(OCCCCC2CCN(C)CC2)ncc1Br.c1ccncc1.
What is the InChIKey of 5-bromo-4-(dimethoxymethyl)-2-[4-(1-methylpiperidin-4-yl)butoxy]pyridine;pyridine?
The InChIKey is KQWZQNNANCMDOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29BrN2O3.C5H5N/c1-21-9-7-14(8-10-21)6-4-5-11-24-17-12-15(16(19)13-20-17)18(22-2)23-3;1-2-4-6-5-3-1/h12-14,18H,4-11H2,1-3H3;1-5H.
What are the key properties of 5-bromo-4-(dimethoxymethyl)-2-[4-(1-methylpiperidin-4-yl)butoxy]pyridine;pyridine?
5-bromo-4-(dimethoxymethyl)-2-[4-(1-methylpiperidin-4-yl)butoxy]pyridine;pyridine has a molecular weight of 480.45 g/mol, XLogP of 5.11, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-(dimethoxymethyl)-2-[4-(1-methylpiperidin-4-yl)butoxy]pyridine;pyridine is sourced from PubChem (CID 141240109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).