C23H30Cl2N4O — CID 143046507
6-chloro-2-[5-chloro-2-[4-(1-methylpiperidin-4-yl)butoxy]-4-pyridinyl]-3a-methyl-1,4-dihydrobenzimidazole (PubChem CID 143046507) has the molecular formula C23H30Cl2N4O and a molecular weight of 449.43 g/mol. Its IUPAC name is 6-chloro-2-[5-chloro-2-[4-(1-methylpiperidin-4-yl)butoxy]-4-pyridinyl]-3a-methyl-1,4-dihydrobenzimidazole.
| Compound Name | 6-chloro-2-[5-chloro-2-[4-(1-methylpiperidin-4-yl)butoxy]-4-pyridinyl]-3a-methyl-1,4-dihydrobenzimidazole |
|---|---|
| PubChem CID | 143046507 |
| Molecular Formula | C23H30Cl2N4O |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 6-chloro-2-[5-chloro-2-[4-(1-methylpiperidin-4-yl)butoxy]-4-pyridinyl]-3a-methyl-1,4-dihydrobenzimidazole |
| SMILES | CN1CCC(CCCCOc2cc(C3=NC4(C)CC=C(Cl)C=C4N3)c(Cl)cn2)CC1 |
| InChI | InChI=1S/C23H30Cl2N4O/c1-23-9-6-17(24)13-20(23)27-22(28-23)18-14-21(26-15-19(18)25)30-12-4-3-5-16-7-10-29(2)11-8-16/h6,13-16H,3-5,7-12H2,1-2H3,(H,27,28) |
| InChIKey | NBPCMPAXLZVIBK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|