C22H29ClN6 — CID 24804884
5-(5-chloro-6-methyl-1H-benzimidazol-2-yl)-4-methyl-N-[3-(1-methylpiperidin-4-yl)propyl]pyrimidin-2-amine (PubChem CID 24804884) has the molecular formula C22H29ClN6 and a molecular weight of 412.97 g/mol. Its IUPAC name is 5-(5-chloro-6-methyl-1H-benzimidazol-2-yl)-4-methyl-N-[3-(1-methylpiperidin-4-yl)propyl]pyrimidin-2-amine.
| Compound Name | 5-(5-chloro-6-methyl-1H-benzimidazol-2-yl)-4-methyl-N-[3-(1-methylpiperidin-4-yl)propyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 24804884 |
| Molecular Formula | C22H29ClN6 |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 5-(5-chloro-6-methyl-1H-benzimidazol-2-yl)-4-methyl-N-[3-(1-methylpiperidin-4-yl)propyl]pyrimidin-2-amine |
| SMILES | Cc1cc2[nH]c(-c3cnc(NCCCC4CCN(C)CC4)nc3C)nc2cc1Cl |
| InChI | InChI=1S/C22H29ClN6/c1-14-11-19-20(12-18(14)23)28-21(27-19)17-13-25-22(26-15(17)2)24-8-4-5-16-6-9-29(3)10-7-16/h11-13,16H,4-10H2,1-3H3,(H,27,28)(H,24,25,26) |
| InChIKey | MXPGCFADRFAYSU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|