C21H31N3O — CID 68657617
5-(4-methoxycyclohexa-1,3-dien-1-yl)-N-[3-(1-methylpiperidin-4-yl)propyl]pyridin-2-amine (PubChem CID 68657617) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is 5-(4-methoxycyclohexa-1,3-dien-1-yl)-N-[3-(1-methylpiperidin-4-yl)propyl]pyridin-2-amine.
| Compound Name | 5-(4-methoxycyclohexa-1,3-dien-1-yl)-N-[3-(1-methylpiperidin-4-yl)propyl]pyridin-2-amine |
|---|---|
| PubChem CID | 68657617 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | 5-(4-methoxycyclohexa-1,3-dien-1-yl)-N-[3-(1-methylpiperidin-4-yl)propyl]pyridin-2-amine |
| SMILES | COC1=CC=C(c2ccc(NCCCC3CCN(C)CC3)nc2)CC1 |
| InChI | InChI=1S/C21H31N3O/c1-24-14-11-17(12-15-24)4-3-13-22-21-10-7-19(16-23-21)18-5-8-20(25-2)9-6-18/h5,7-8,10,16-17H,3-4,6,9,11-15H2,1-2H3,(H,22,23) |
| InChIKey | XBLFIOAUQQBTNB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|