C21H26ClN5 — CID 68658202
5-(1-chlorobenzimidazol-2-yl)-N-[3-(1-methylpiperidin-4-yl)propyl]pyridin-2-amine (PubChem CID 68658202) has the molecular formula C21H26ClN5 and a molecular weight of 383.93 g/mol. Its IUPAC name is 5-(1-chlorobenzimidazol-2-yl)-N-[3-(1-methylpiperidin-4-yl)propyl]pyridin-2-amine.
| Compound Name | 5-(1-chlorobenzimidazol-2-yl)-N-[3-(1-methylpiperidin-4-yl)propyl]pyridin-2-amine |
|---|---|
| PubChem CID | 68658202 |
| Molecular Formula | C21H26ClN5 |
| Molecular Weight | 383.93 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 5-(1-chlorobenzimidazol-2-yl)-N-[3-(1-methylpiperidin-4-yl)propyl]pyridin-2-amine |
| SMILES | CN1CCC(CCCNc2ccc(-c3nc4ccccc4n3Cl)cn2)CC1 |
| InChI | InChI=1S/C21H26ClN5/c1-26-13-10-16(11-14-26)5-4-12-23-20-9-8-17(15-24-20)21-25-18-6-2-3-7-19(18)27(21)22/h2-3,6-9,15-16H,4-5,10-14H2,1H3,(H,23,24) |
| InChIKey | OGYCFWVZYGKKPQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.93 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|