C21H22N4O — CID 58646802
[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(6-phenyl-1H-benzimidazol-2-yl)methanone (PubChem CID 58646802) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is [(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(6-phenyl-1H-benzimidazol-2-yl)methanone.
| Compound Name | [(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(6-phenyl-1H-benzimidazol-2-yl)methanone |
|---|---|
| PubChem CID | 58646802 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(6-phenyl-1H-benzimidazol-2-yl)methanone |
| SMILES | CN1C[C@@H]2CN(C(=O)c3nc4ccc(-c5ccccc5)cc4[nH]3)C[C@@H]2C1 |
| InChI | InChI=1S/C21H22N4O/c1-24-10-16-12-25(13-17(16)11-24)21(26)20-22-18-8-7-15(9-19(18)23-20)14-5-3-2-4-6-14/h2-9,16-17H,10-13H2,1H3,(H,22,23)/t16-,17+ |
| InChIKey | QIGOVWKQCUWSMY-CALCHBBNSA-N |
| XLogP | 2.86 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |