C31H32F3N3O — CID 67436582
1-methyl-4-[3-[3-phenyl-4-[4-phenyl-5-(trifluoromethyl)-1H-imidazol-2-yl]phenoxy]propyl]piperidine (PubChem CID 67436582) has the molecular formula C31H32F3N3O and a molecular weight of 519.61 g/mol. Its IUPAC name is 1-methyl-4-[3-[3-phenyl-4-[4-phenyl-5-(trifluoromethyl)-1H-imidazol-2-yl]phenoxy]propyl]piperidine.
| Compound Name | 1-methyl-4-[3-[3-phenyl-4-[4-phenyl-5-(trifluoromethyl)-1H-imidazol-2-yl]phenoxy]propyl]piperidine |
|---|---|
| PubChem CID | 67436582 |
| Molecular Formula | C31H32F3N3O |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | 1-methyl-4-[3-[3-phenyl-4-[4-phenyl-5-(trifluoromethyl)-1H-imidazol-2-yl]phenoxy]propyl]piperidine |
| SMILES | CN1CCC(CCCOc2ccc(-c3nc(-c4ccccc4)c(C(F)(F)F)[nH]3)c(-c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C31H32F3N3O/c1-37-18-16-22(17-19-37)9-8-20-38-25-14-15-26(27(21-25)23-10-4-2-5-11-23)30-35-28(24-12-6-3-7-13-24)29(36-30)31(32,33)34/h2-7,10-15,21-22H,8-9,16-20H2,1H3,(H,35,36) |
| InChIKey | OAUMJGMZFWWRRI-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|