C24H27Cl2N3O — CID 11619174
4-[3-[3-chloro-4-[4-(4-chlorophenyl)-5-methyl-1H-imidazol-2-yl]phenoxy]propyl]piperidine (PubChem CID 11619174) has the molecular formula C24H27Cl2N3O and a molecular weight of 444.41 g/mol. Its IUPAC name is 4-[3-[3-chloro-4-[4-(4-chlorophenyl)-5-methyl-1H-imidazol-2-yl]phenoxy]propyl]piperidine.
| Compound Name | 4-[3-[3-chloro-4-[4-(4-chlorophenyl)-5-methyl-1H-imidazol-2-yl]phenoxy]propyl]piperidine |
|---|---|
| PubChem CID | 11619174 |
| Molecular Formula | C24H27Cl2N3O |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 4-[3-[3-chloro-4-[4-(4-chlorophenyl)-5-methyl-1H-imidazol-2-yl]phenoxy]propyl]piperidine |
| SMILES | Cc1[nH]c(-c2ccc(OCCCC3CCNCC3)cc2Cl)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H27Cl2N3O/c1-16-23(18-4-6-19(25)7-5-18)29-24(28-16)21-9-8-20(15-22(21)26)30-14-2-3-17-10-12-27-13-11-17/h4-9,15,17,27H,2-3,10-14H2,1H3,(H,28,29) |
| InChIKey | CUADEYRLQBPWLW-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|