C21H31ClN2O3 — CID 123284650
2-[2-chloro-4-(4-piperidin-4-ylbutoxy)phenyl]-1-(3-methoxyazetidin-1-yl)ethanone (PubChem CID 123284650) has the molecular formula C21H31ClN2O3 and a molecular weight of 394.94 g/mol. Its IUPAC name is 2-[2-chloro-4-(4-piperidin-4-ylbutoxy)phenyl]-1-(3-methoxyazetidin-1-yl)ethanone.
| Compound Name | 2-[2-chloro-4-(4-piperidin-4-ylbutoxy)phenyl]-1-(3-methoxyazetidin-1-yl)ethanone |
|---|---|
| PubChem CID | 123284650 |
| Molecular Formula | C21H31ClN2O3 |
| Molecular Weight | 394.94 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-[2-chloro-4-(4-piperidin-4-ylbutoxy)phenyl]-1-(3-methoxyazetidin-1-yl)ethanone |
| SMILES | COC1CN(C(=O)Cc2ccc(OCCCCC3CCNCC3)cc2Cl)C1 |
| InChI | InChI=1S/C21H31ClN2O3/c1-26-19-14-24(15-19)21(25)12-17-5-6-18(13-20(17)22)27-11-3-2-4-16-7-9-23-10-8-16/h5-6,13,16,19,23H,2-4,7-12,14-15H2,1H3 |
| InChIKey | QDZDFLGYZQGACA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.94 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|