About 2-[2,6-difluoro-4-(5-piperidin-4-ylpentoxy)phenyl]-1-(3-fluoroazetidin-1-yl)ethanone
2-[2,6-difluoro-4-(5-piperidin-4-ylpentoxy)phenyl]-1-(3-fluoroazetidin-1-yl)ethanone (PubChem CID 123294445) has the molecular formula C21H29F3N2O2
and a molecular weight of 398.47 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-(5-piperidin-4-ylpentoxy)phenyl]-1-(3-fluoroazetidin-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-[2,6-difluoro-4-(5-piperidin-4-ylpentoxy)phenyl]-1-(3-fluoroazetidin-1-yl)ethanone |
| PubChem CID | 123294445 |
| Molecular Formula | C21H29F3N2O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 2-[2,6-difluoro-4-(5-piperidin-4-ylpentoxy)phenyl]-1-(3-fluoroazetidin-1-yl)ethanone |
| SMILES | O=C(Cc1c(F)cc(OCCCCCC2CCNCC2)cc1F)N1CC(F)C1 |
| InChI | InChI=1S/C21H29F3N2O2/c22-16-13-26(14-16)21(27)12-18-19(23)10-17(11-20(18)24)28-9-3-1-2-4-15-5-7-25-8-6-15/h10-11,15-16,25H,1-9,12-14H2 |
| InChIKey | CGRRQQHJICHTBC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,6-difluoro-4-(5-piperidin-4-ylpentoxy)phenyl]-1-(3-fluoroazetidin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,6-difluoro-4-(5-piperidin-4-ylpentoxy)phenyl]-1-(3-fluoroazetidin-1-yl)ethanone?
The IUPAC name of 2-[2,6-difluoro-4-(5-piperidin-4-ylpentoxy)phenyl]-1-(3-fluoroazetidin-1-yl)ethanone (CID 123294445) is 2-[2,6-difluoro-4-(5-piperidin-4-ylpentoxy)phenyl]-1-(3-fluoroazetidin-1-yl)ethanone.
What is the SMILES notation for 2-[2,6-difluoro-4-(5-piperidin-4-ylpentoxy)phenyl]-1-(3-fluoroazetidin-1-yl)ethanone?
The canonical SMILES for 2-[2,6-difluoro-4-(5-piperidin-4-ylpentoxy)phenyl]-1-(3-fluoroazetidin-1-yl)ethanone is O=C(Cc1c(F)cc(OCCCCCC2CCNCC2)cc1F)N1CC(F)C1.
What is the InChIKey of 2-[2,6-difluoro-4-(5-piperidin-4-ylpentoxy)phenyl]-1-(3-fluoroazetidin-1-yl)ethanone?
The InChIKey is CGRRQQHJICHTBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29F3N2O2/c22-16-13-26(14-16)21(27)12-18-19(23)10-17(11-20(18)24)28-9-3-1-2-4-15-5-7-25-8-6-15/h10-11,15-16,25H,1-9,12-14H2.
What are the key properties of 2-[2,6-difluoro-4-(5-piperidin-4-ylpentoxy)phenyl]-1-(3-fluoroazetidin-1-yl)ethanone?
2-[2,6-difluoro-4-(5-piperidin-4-ylpentoxy)phenyl]-1-(3-fluoroazetidin-1-yl)ethanone has a molecular weight of 398.47 g/mol, XLogP of 3.63, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,6-difluoro-4-(5-piperidin-4-ylpentoxy)phenyl]-1-(3-fluoroazetidin-1-yl)ethanone is sourced from PubChem (CID 123294445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).