C21H29F3N2O2 — CID 123294445
2-[2,6-difluoro-4-(5-piperidin-4-ylpentoxy)phenyl]-1-(3-fluoroazetidin-1-yl)ethanone (PubChem CID 123294445) has the molecular formula C21H29F3N2O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-(5-piperidin-4-ylpentoxy)phenyl]-1-(3-fluoroazetidin-1-yl)ethanone.
| Compound Name | 2-[2,6-difluoro-4-(5-piperidin-4-ylpentoxy)phenyl]-1-(3-fluoroazetidin-1-yl)ethanone |
|---|---|
| PubChem CID | 123294445 |
| Molecular Formula | C21H29F3N2O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 2-[2,6-difluoro-4-(5-piperidin-4-ylpentoxy)phenyl]-1-(3-fluoroazetidin-1-yl)ethanone |
| SMILES | O=C(Cc1c(F)cc(OCCCCCC2CCNCC2)cc1F)N1CC(F)C1 |
| InChI | InChI=1S/C21H29F3N2O2/c22-16-13-26(14-16)21(27)12-18-19(23)10-17(11-20(18)24)28-9-3-1-2-4-15-5-7-25-8-6-15/h10-11,15-16,25H,1-9,12-14H2 |
| InChIKey | CGRRQQHJICHTBC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|