C20H29NO4 — CID 23377825
2-[[6-(3-piperidin-4-ylpropoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]oxy]acetic acid (PubChem CID 23377825) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-[[6-(3-piperidin-4-ylpropoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]oxy]acetic acid.
| Compound Name | 2-[[6-(3-piperidin-4-ylpropoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 23377825 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 2-[[6-(3-piperidin-4-ylpropoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]oxy]acetic acid |
| SMILES | O=C(O)COC1CCc2cc(OCCCC3CCNCC3)ccc2C1 |
| InChI | InChI=1S/C20H29NO4/c22-20(23)14-25-19-6-4-16-12-18(5-3-17(16)13-19)24-11-1-2-15-7-9-21-10-8-15/h3,5,12,15,19,21H,1-2,4,6-11,13-14H2,(H,22,23) |
| InChIKey | BQNFLFRAIMGRFQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|