C20H27NO4 — CID 23377814
2-[1-oxo-6-(3-piperidin-4-ylpropoxy)-3,4-dihydro-2H-naphthalen-2-yl]acetic acid (PubChem CID 23377814) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-[1-oxo-6-(3-piperidin-4-ylpropoxy)-3,4-dihydro-2H-naphthalen-2-yl]acetic acid.
| Compound Name | 2-[1-oxo-6-(3-piperidin-4-ylpropoxy)-3,4-dihydro-2H-naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 23377814 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 2-[1-oxo-6-(3-piperidin-4-ylpropoxy)-3,4-dihydro-2H-naphthalen-2-yl]acetic acid |
| SMILES | O=C(O)CC1CCc2cc(OCCCC3CCNCC3)ccc2C1=O |
| InChI | InChI=1S/C20H27NO4/c22-19(23)13-16-4-3-15-12-17(5-6-18(15)20(16)24)25-11-1-2-14-7-9-21-10-8-14/h5-6,12,14,16,21H,1-4,7-11,13H2,(H,22,23) |
| InChIKey | AXPZXYPFVCHRGT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|