C26H32N2O4 — CID 23377815
2-(N-[1-oxo-6-(3-piperidin-4-ylpropoxy)-3,4-dihydro-2H-naphthalen-2-yl]anilino)acetic acid (PubChem CID 23377815) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is 2-(N-[1-oxo-6-(3-piperidin-4-ylpropoxy)-3,4-dihydro-2H-naphthalen-2-yl]anilino)acetic acid.
| Compound Name | 2-(N-[1-oxo-6-(3-piperidin-4-ylpropoxy)-3,4-dihydro-2H-naphthalen-2-yl]anilino)acetic acid |
|---|---|
| PubChem CID | 23377815 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 2-(N-[1-oxo-6-(3-piperidin-4-ylpropoxy)-3,4-dihydro-2H-naphthalen-2-yl]anilino)acetic acid |
| SMILES | O=C(O)CN(c1ccccc1)C1CCc2cc(OCCCC3CCNCC3)ccc2C1=O |
| InChI | InChI=1S/C26H32N2O4/c29-25(30)18-28(21-6-2-1-3-7-21)24-11-8-20-17-22(9-10-23(20)26(24)31)32-16-4-5-19-12-14-27-15-13-19/h1-3,6-7,9-10,17,19,24,27H,4-5,8,11-16,18H2,(H,29,30) |
| InChIKey | MXBFEUXZFRJENT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|