C21H29NO4 — CID 57022198
tert-butyl N-[3-[[(6S)-5-oxo-6-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl]oxy]propyl]carbamate (PubChem CID 57022198) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is tert-butyl N-[3-[[(6S)-5-oxo-6-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl]oxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[(6S)-5-oxo-6-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl]oxy]propyl]carbamate |
|---|---|
| PubChem CID | 57022198 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | tert-butyl N-[3-[[(6S)-5-oxo-6-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl]oxy]propyl]carbamate |
| SMILES | C=CC[C@@H]1CCc2cc(OCCCNC(=O)OC(C)(C)C)ccc2C1=O |
| InChI | InChI=1S/C21H29NO4/c1-5-7-15-8-9-16-14-17(10-11-18(16)19(15)23)25-13-6-12-22-20(24)26-21(2,3)4/h5,10-11,14-15H,1,6-9,12-13H2,2-4H3,(H,22,24)/t15-/m1/s1 |
| InChIKey | XYDIQTLHTXCYIB-OAHLLOKOSA-N |
| XLogP | 4.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|