C19H30N2O4 — CID 70666352
N-(1,3-dihydroxypropan-2-yl)-2-methyl-4-(3-piperidin-4-ylpropoxy)benzamide (PubChem CID 70666352) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-2-methyl-4-(3-piperidin-4-ylpropoxy)benzamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-2-methyl-4-(3-piperidin-4-ylpropoxy)benzamide |
|---|---|
| PubChem CID | 70666352 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-2-methyl-4-(3-piperidin-4-ylpropoxy)benzamide |
| SMILES | Cc1cc(OCCCC2CCNCC2)ccc1C(=O)NC(CO)CO |
| InChI | InChI=1S/C19H30N2O4/c1-14-11-17(25-10-2-3-15-6-8-20-9-7-15)4-5-18(14)19(24)21-16(12-22)13-23/h4-5,11,15-16,20,22-23H,2-3,6-10,12-13H2,1H3,(H,21,24) |
| InChIKey | NWYXPXCZVKKALE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|