C13H23N3O2 — CID 68876252
3-hydroxy-N-[(3S)-piperidin-3-yl]-8-azabicyclo[3.2.1]octane-8-carboxamide (PubChem CID 68876252) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 3-hydroxy-N-[(3S)-piperidin-3-yl]-8-azabicyclo[3.2.1]octane-8-carboxamide.
| Compound Name | 3-hydroxy-N-[(3S)-piperidin-3-yl]-8-azabicyclo[3.2.1]octane-8-carboxamide |
|---|---|
| PubChem CID | 68876252 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 3-hydroxy-N-[(3S)-piperidin-3-yl]-8-azabicyclo[3.2.1]octane-8-carboxamide |
| SMILES | O=C(N[C@H]1CCCNC1)N1C2CCC1CC(O)C2 |
| InChI | InChI=1S/C13H23N3O2/c17-12-6-10-3-4-11(7-12)16(10)13(18)15-9-2-1-5-14-8-9/h9-12,14,17H,1-8H2,(H,15,18)/t9-,10?,11?,12?/m0/s1 |
| InChIKey | KTWXSWSVNHAWGM-ZLMIFYAYSA-N |
| XLogP | 0.44 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |