C19H28N4O2 — CID 68873576
(1S,5R)-N-[(3S)-1-(4-aminophenyl)piperidin-3-yl]-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxamide (PubChem CID 68873576) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is (1S,5R)-N-[(3S)-1-(4-aminophenyl)piperidin-3-yl]-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxamide.
| Compound Name | (1S,5R)-N-[(3S)-1-(4-aminophenyl)piperidin-3-yl]-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxamide |
|---|---|
| PubChem CID | 68873576 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (1S,5R)-N-[(3S)-1-(4-aminophenyl)piperidin-3-yl]-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxamide |
| SMILES | Nc1ccc(N2CCC[C@H](NC(=O)N3[C@@H]4CC[C@H]3CC(O)C4)C2)cc1 |
| InChI | InChI=1S/C19H28N4O2/c20-13-3-5-15(6-4-13)22-9-1-2-14(12-22)21-19(25)23-16-7-8-17(23)11-18(24)10-16/h3-6,14,16-18,24H,1-2,7-12,20H2,(H,21,25)/t14-,16-,17+,18?/m0/s1 |
| InChIKey | KSQSFNCEDWAQDJ-QTXGHNMQSA-N |
| XLogP | 1.93 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|