C24H26N2O3 — CID 68877183
tert-butyl-[[4-[(naphthalene-1-carbonylamino)methyl]phenyl]methyl]carbamic acid (PubChem CID 68877183) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is tert-butyl-[[4-[(naphthalene-1-carbonylamino)methyl]phenyl]methyl]carbamic acid.
| Compound Name | tert-butyl-[[4-[(naphthalene-1-carbonylamino)methyl]phenyl]methyl]carbamic acid |
|---|---|
| PubChem CID | 68877183 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | tert-butyl-[[4-[(naphthalene-1-carbonylamino)methyl]phenyl]methyl]carbamic acid |
| SMILES | CC(C)(C)N(Cc1ccc(CNC(=O)c2cccc3ccccc23)cc1)C(=O)O |
| InChI | InChI=1S/C24H26N2O3/c1-24(2,3)26(23(28)29)16-18-13-11-17(12-14-18)15-25-22(27)21-10-6-8-19-7-4-5-9-20(19)21/h4-14H,15-16H2,1-3H3,(H,25,27)(H,28,29) |
| InChIKey | KCLYDCPYHDWJKS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |